C12H22F2N2O2S — CID 115053350
4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)azepan-4-amine (PubChem CID 115053350) has the molecular formula C12H22F2N2O2S and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)azepan-4-amine.
| Compound Name | 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)azepan-4-amine |
|---|---|
| PubChem CID | 115053350 |
| Molecular Formula | C12H22F2N2O2S |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-(difluoromethyl)-1-(1,1-dioxothian-4-yl)azepan-4-amine |
| SMILES | NC1(C(F)F)CCCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H22F2N2O2S/c13-11(14)12(15)4-1-6-16(7-5-12)10-2-8-19(17,18)9-3-10/h10-11H,1-9,15H2 |
| InChIKey | OCQCCUBTHWTEOJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |