C12H23FN2O2S — CID 115051330
1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)azepan-4-amine (PubChem CID 115051330) has the molecular formula C12H23FN2O2S and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)azepan-4-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)azepan-4-amine |
|---|---|
| PubChem CID | 115051330 |
| Molecular Formula | C12H23FN2O2S |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-4-(fluoromethyl)azepan-4-amine |
| SMILES | NC1(CF)CCCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H23FN2O2S/c13-10-12(14)4-1-6-15(7-5-12)11-2-8-18(16,17)9-3-11/h11H,1-10,14H2 |
| InChIKey | INRFCMDMVSFELA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |