About 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride
2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride (PubChem CID 115054389) has the molecular formula C11H13BrClF2N
and a molecular weight of 312.58 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride |
| PubChem CID | 115054389 |
| Molecular Formula | C11H13BrClF2N |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride |
| SMILES | Cl.FC1(F)CCCNC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrF2N.ClH/c12-9-4-2-8(3-5-9)10-11(13,14)6-1-7-15-10;/h2-5,10,15H,1,6-7H2;1H |
| InChIKey | UUTCAWYIPPJVHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride?
The IUPAC name of 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride (CID 115054389) is 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride.
What is the SMILES notation for 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride?
The canonical SMILES for 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride is Cl.FC1(F)CCCNC1c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride?
The InChIKey is UUTCAWYIPPJVHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrF2N.ClH/c12-9-4-2-8(3-5-9)10-11(13,14)6-1-7-15-10;/h2-5,10,15H,1,6-7H2;1H.
What are the key properties of 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride?
2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride has a molecular weight of 312.58 g/mol, XLogP of 3.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride is sourced from PubChem (CID 115054389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).