C11H13BrClF2N — CID 115054389
2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride (PubChem CID 115054389) has the molecular formula C11H13BrClF2N and a molecular weight of 312.58 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride.
| Compound Name | 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride |
|---|---|
| PubChem CID | 115054389 |
| Molecular Formula | C11H13BrClF2N |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 2-(4-bromophenyl)-3,3-difluoropiperidine;hydrochloride |
| SMILES | Cl.FC1(F)CCCNC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrF2N.ClH/c12-9-4-2-8(3-5-9)10-11(13,14)6-1-7-15-10;/h2-5,10,15H,1,6-7H2;1H |
| InChIKey | UUTCAWYIPPJVHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |