C12H15BrF2 — CID 167467914
1-bromo-4-(3,3-difluorocyclobutyl)benzene;ethane (PubChem CID 167467914) has the molecular formula C12H15BrF2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 1-bromo-4-(3,3-difluorocyclobutyl)benzene;ethane.
| Compound Name | 1-bromo-4-(3,3-difluorocyclobutyl)benzene;ethane |
|---|---|
| PubChem CID | 167467914 |
| Molecular Formula | C12H15BrF2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-bromo-4-(3,3-difluorocyclobutyl)benzene;ethane |
| SMILES | CC.FC1(F)CC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C10H9BrF2.C2H6/c11-9-3-1-7(2-4-9)8-5-10(12,13)6-8;1-2/h1-4,8H,5-6H2;1-2H3 |
| InChIKey | BKNPZHOKIQGJQL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |