C14H17BrF3N — CID 168993350
4-(4-bromophenyl)-1-(1,1,1-trifluoropropan-2-yl)piperidine (PubChem CID 168993350) has the molecular formula C14H17BrF3N and a molecular weight of 336.20 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-(1,1,1-trifluoropropan-2-yl)piperidine.
| Compound Name | 4-(4-bromophenyl)-1-(1,1,1-trifluoropropan-2-yl)piperidine |
|---|---|
| PubChem CID | 168993350 |
| Molecular Formula | C14H17BrF3N |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-(4-bromophenyl)-1-(1,1,1-trifluoropropan-2-yl)piperidine |
| SMILES | CC(N1CCC(c2ccc(Br)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3N/c1-10(14(16,17)18)19-8-6-12(7-9-19)11-2-4-13(15)5-3-11/h2-5,10,12H,6-9H2,1H3 |
| InChIKey | KITCHTNYSFMLMZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |