C11H15N5 — CID 115056348
4-(aminomethyl)-1-(2-methylphenyl)pyrazole-3,5-diamine (PubChem CID 115056348) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(2-methylphenyl)pyrazole-3,5-diamine.
| Compound Name | 4-(aminomethyl)-1-(2-methylphenyl)pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 115056348 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-(aminomethyl)-1-(2-methylphenyl)pyrazole-3,5-diamine |
| SMILES | Cc1ccccc1-n1nc(N)c(CN)c1N |
| InChI | InChI=1S/C11H15N5/c1-7-4-2-3-5-9(7)16-11(14)8(6-12)10(13)15-16/h2-5H,6,12,14H2,1H3,(H2,13,15) |
| InChIKey | JRIADJUOQCBSFV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |