C12H17N5O — CID 115056392
4-(2-aminoethyl)-1-(2-methoxyphenyl)pyrazole-3,5-diamine (PubChem CID 115056392) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1-(2-methoxyphenyl)pyrazole-3,5-diamine.
| Compound Name | 4-(2-aminoethyl)-1-(2-methoxyphenyl)pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 115056392 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-(2-aminoethyl)-1-(2-methoxyphenyl)pyrazole-3,5-diamine |
| SMILES | COc1ccccc1-n1nc(N)c(CCN)c1N |
| InChI | InChI=1S/C12H17N5O/c1-18-10-5-3-2-4-9(10)17-12(15)8(6-7-13)11(14)16-17/h2-5H,6-7,13,15H2,1H3,(H2,14,16) |
| InChIKey | GQAQYUCNKDUKBW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |