C11H14N4O — CID 83821894
2-[1-(2-methoxyphenyl)-1,2,4-triazol-3-yl]ethanamine (PubChem CID 83821894) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-[1-(2-methoxyphenyl)-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 83821894 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)-1,2,4-triazol-3-yl]ethanamine |
| SMILES | COc1ccccc1-n1cnc(CCN)n1 |
| InChI | InChI=1S/C11H14N4O/c1-16-10-5-3-2-4-9(10)15-8-13-11(14-15)6-7-12/h2-5,8H,6-7,12H2,1H3 |
| InChIKey | XKEBQGFMSVSTKB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |