C10H11FN4 — CID 83820004
2-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethanamine (PubChem CID 83820004) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 2-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 83820004 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-1,2,4-triazol-3-yl]ethanamine |
| SMILES | NCCc1ncn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C10H11FN4/c11-8-1-3-9(4-2-8)15-7-13-10(14-15)5-6-12/h1-4,7H,5-6,12H2 |
| InChIKey | MHDCYJVIIDCBRK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |