C14H20N4 — CID 141055076
4-(3-butyl-1,2,4-triazol-1-yl)-N,N-dimethylaniline (PubChem CID 141055076) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(3-butyl-1,2,4-triazol-1-yl)-N,N-dimethylaniline.
| Compound Name | 4-(3-butyl-1,2,4-triazol-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 141055076 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(3-butyl-1,2,4-triazol-1-yl)-N,N-dimethylaniline |
| SMILES | CCCCc1ncn(-c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C14H20N4/c1-4-5-6-14-15-11-18(16-14)13-9-7-12(8-10-13)17(2)3/h7-11H,4-6H2,1-3H3 |
| InChIKey | PZXXFONMUSALDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|