C6H10ClN3 — CID 169084532
3-butyl-1-chloro-1,2,4-triazole (PubChem CID 169084532) has the molecular formula C6H10ClN3 and a molecular weight of 159.62 g/mol. Its IUPAC name is 3-butyl-1-chloro-1,2,4-triazole.
| Compound Name | 3-butyl-1-chloro-1,2,4-triazole |
|---|---|
| PubChem CID | 169084532 |
| Molecular Formula | C6H10ClN3 |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 3-butyl-1-chloro-1,2,4-triazole |
| SMILES | CCCCc1ncn(Cl)n1 |
| InChI | InChI=1S/C6H10ClN3/c1-2-3-4-6-8-5-10(7)9-6/h5H,2-4H2,1H3 |
| InChIKey | WHOFHALLGLDUMF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |