C17H34N4 — CID 159936567
N-[(3-butyl-1,2,4-triazol-1-yl)methyl]-N-pentylpentan-1-amine (PubChem CID 159936567) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[(3-butyl-1,2,4-triazol-1-yl)methyl]-N-pentylpentan-1-amine.
| Compound Name | N-[(3-butyl-1,2,4-triazol-1-yl)methyl]-N-pentylpentan-1-amine |
|---|---|
| PubChem CID | 159936567 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | N-[(3-butyl-1,2,4-triazol-1-yl)methyl]-N-pentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)Cn1cnc(CCCC)n1 |
| InChI | InChI=1S/C17H34N4/c1-4-7-10-13-20(14-11-8-5-2)16-21-15-18-17(19-21)12-9-6-3/h15H,4-14,16H2,1-3H3 |
| InChIKey | OAIBYJLAZADIBP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|