C16H19NO2 — CID 142008692
3-butyl-4-[4-(dimethylamino)phenyl]cyclobut-3-ene-1,2-dione (PubChem CID 142008692) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-butyl-4-[4-(dimethylamino)phenyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-butyl-4-[4-(dimethylamino)phenyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142008692 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-butyl-4-[4-(dimethylamino)phenyl]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCc1c(-c2ccc(N(C)C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C16H19NO2/c1-4-5-6-13-14(16(19)15(13)18)11-7-9-12(10-8-11)17(2)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | LNZCYEXBHAURPC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|