C22H27FN4O3 — CID 58324079
4-[1-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline (PubChem CID 58324079) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[1-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58324079 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[1-[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-1,2,4-triazol-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ncn(-c3ccc(OCCOCCOCCF)cc3)n2)cc1 |
| InChI | InChI=1S/C22H27FN4O3/c1-26(2)19-5-3-18(4-6-19)22-24-17-27(25-22)20-7-9-21(10-8-20)30-16-15-29-14-13-28-12-11-23/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | WJGTUPRTNKXYNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|