C10H12N4O2 — CID 115056385
2-[3,5-diamino-4-(hydroxymethyl)pyrazol-1-yl]phenol (PubChem CID 115056385) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[3,5-diamino-4-(hydroxymethyl)pyrazol-1-yl]phenol.
| Compound Name | 2-[3,5-diamino-4-(hydroxymethyl)pyrazol-1-yl]phenol |
|---|---|
| PubChem CID | 115056385 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[3,5-diamino-4-(hydroxymethyl)pyrazol-1-yl]phenol |
| SMILES | Nc1nn(-c2ccccc2O)c(N)c1CO |
| InChI | InChI=1S/C10H12N4O2/c11-9-6(5-15)10(12)14(13-9)7-3-1-2-4-8(7)16/h1-4,15-16H,5,12H2,(H2,11,13) |
| InChIKey | UUUVNSWGOAQRCH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |