2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid

C11H12N4O2 — CID 115056344

IUPAC2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid
SMILESNc1nn(-c2ccccc2)c(N)c1CC(=O)O
InChIInChI=1S/C11H12N4O2/c12-10-8(6-9(16)17)11(13)15(14-10)7-4-2-1-3-5-7/h1-5H,6,13H2,(H2,12,14)(H,16,17)
InChIKeyRSIGFZKUKSASBT-UHFFFAOYSA-N
MW232.24 g/mol
LogP0.66
Rot. Bonds3

About 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid

2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid (PubChem CID 115056344) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid
PubChem CID115056344
Molecular FormulaC11H12N4O2
Molecular Weight232.24 g/mol
Exact Mass232.10
IUPAC Name2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid
SMILESNc1nn(-c2ccccc2)c(N)c1CC(=O)O
InChIInChI=1S/C11H12N4O2/c12-10-8(6-9(16)17)11(13)15(14-10)7-4-2-1-3-5-7/h1-5H,6,13H2,(H2,12,14)(H,16,17)
InChIKeyRSIGFZKUKSASBT-UHFFFAOYSA-N
XLogP0.66
TPSA107.16 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 50.66
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid?
The IUPAC name of 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid (CID 115056344) is 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid?
The canonical SMILES for 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid is Nc1nn(-c2ccccc2)c(N)c1CC(=O)O.
What is the InChIKey of 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid?
The InChIKey is RSIGFZKUKSASBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c12-10-8(6-9(16)17)11(13)15(14-10)7-4-2-1-3-5-7/h1-5H,6,13H2,(H2,12,14)(H,16,17).
What are the key properties of 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid?
2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid has a molecular weight of 232.24 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-diamino-1-phenylpyrazol-4-yl)acetic acid is sourced from PubChem (CID 115056344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).