C19H18N2O2 — CID 10614604
2-(4-ethyl-1,5-diphenylpyrazol-3-yl)acetic acid (PubChem CID 10614604) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(4-ethyl-1,5-diphenylpyrazol-3-yl)acetic acid.
| Compound Name | 2-(4-ethyl-1,5-diphenylpyrazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 10614604 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(4-ethyl-1,5-diphenylpyrazol-3-yl)acetic acid |
| SMILES | CCc1c(CC(=O)O)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c1-2-16-17(13-18(22)23)20-21(15-11-7-4-8-12-15)19(16)14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,22,23) |
| InChIKey | QFSUFPDPGDITOX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |