4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid

C19H19N2O2+ — CID 166436938

IUPAC4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid
SMILESCCc1c(-c2ccccc2)n(-c2ccccc2)[n+](C)c1C(=O)O
InChIInChI=1S/C19H18N2O2/c1-3-16-17(14-10-6-4-7-11-14)21(15-12-8-5-9-13-15)20(2)18(16)19(22)23/h4-13H,3H2,1-2H3/p+1
InChIKeyGVIYXBCQGHPZIS-UHFFFAOYSA-O
MW307.37 g/mol
LogP3.23
Rot. Bonds4

About 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid

4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid (PubChem CID 166436938) has the molecular formula C19H19N2O2+ and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid
PubChem CID166436938
Molecular FormulaC19H19N2O2+
Molecular Weight307.37 g/mol
Exact Mass307.14
IUPAC Name4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid
SMILESCCc1c(-c2ccccc2)n(-c2ccccc2)[n+](C)c1C(=O)O
InChIInChI=1S/C19H18N2O2/c1-3-16-17(14-10-6-4-7-11-14)21(15-12-8-5-9-13-15)20(2)18(16)19(22)23/h4-13H,3H2,1-2H3/p+1
InChIKeyGVIYXBCQGHPZIS-UHFFFAOYSA-O
XLogP3.23
TPSA46.11 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.37
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid?
The IUPAC name of 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid (CID 166436938) is 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid?
The canonical SMILES for 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid is CCc1c(-c2ccccc2)n(-c2ccccc2)[n+](C)c1C(=O)O.
What is the InChIKey of 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid?
The InChIKey is GVIYXBCQGHPZIS-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H18N2O2/c1-3-16-17(14-10-6-4-7-11-14)21(15-12-8-5-9-13-15)20(2)18(16)19(22)23/h4-13H,3H2,1-2H3/p+1.
What are the key properties of 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid?
4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid has a molecular weight of 307.37 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyl-1,5-diphenylpyrazol-2-ium-3-carboxylic acid is sourced from PubChem (CID 166436938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).