C20H19NO2 — CID 68665396
1-benzyl-4-ethyl-2-phenylpyrrole-3-carboxylic acid (PubChem CID 68665396) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-benzyl-4-ethyl-2-phenylpyrrole-3-carboxylic acid.
| Compound Name | 1-benzyl-4-ethyl-2-phenylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 68665396 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-benzyl-4-ethyl-2-phenylpyrrole-3-carboxylic acid |
| SMILES | CCc1cn(Cc2ccccc2)c(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C20H19NO2/c1-2-16-14-21(13-15-9-5-3-6-10-15)19(18(16)20(22)23)17-11-7-4-8-12-17/h3-12,14H,2,13H2,1H3,(H,22,23) |
| InChIKey | VPOJMIRTKRXAHV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |