C17H21N — CID 15438946
1-benzyl-3-ethyl-4,5,6,7-tetrahydroindole (PubChem CID 15438946) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-4,5,6,7-tetrahydroindole.
| Compound Name | 1-benzyl-3-ethyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 15438946 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-benzyl-3-ethyl-4,5,6,7-tetrahydroindole |
| SMILES | CCc1cn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C17H21N/c1-2-15-13-18(12-14-8-4-3-5-9-14)17-11-7-6-10-16(15)17/h3-5,8-9,13H,2,6-7,10-12H2,1H3 |
| InChIKey | HBTMUFNNPQBSLS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |