C20H20ClN — CID 56623019
9-[(4-chlorophenyl)methyl]-8-methyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 56623019) has the molecular formula C20H20ClN and a molecular weight of 309.84 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-8-methyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 9-[(4-chlorophenyl)methyl]-8-methyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 56623019 |
| Molecular Formula | C20H20ClN |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-8-methyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | Cc1cccc2c3c(n(Cc4ccc(Cl)cc4)c12)CCCC3 |
| InChI | InChI=1S/C20H20ClN/c1-14-5-4-7-18-17-6-2-3-8-19(17)22(20(14)18)13-15-9-11-16(21)12-10-15/h4-5,7,9-12H,2-3,6,8,13H2,1H3 |
| InChIKey | JNUMYWHVYAHGQM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|