C18H19N — CID 130355396
11-ethyl-7,8,9,10-tetrahydrobenzo[a]carbazole (PubChem CID 130355396) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 11-ethyl-7,8,9,10-tetrahydrobenzo[a]carbazole.
| Compound Name | 11-ethyl-7,8,9,10-tetrahydrobenzo[a]carbazole |
|---|---|
| PubChem CID | 130355396 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 11-ethyl-7,8,9,10-tetrahydrobenzo[a]carbazole |
| SMILES | CCn1c2c(c3ccc4ccccc4c31)CCCC2 |
| InChI | InChI=1S/C18H19N/c1-2-19-17-10-6-5-9-15(17)16-12-11-13-7-3-4-8-14(13)18(16)19/h3-4,7-8,11-12H,2,5-6,9-10H2,1H3 |
| InChIKey | VNEBGYWAMJSAIK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|