C20H20ClNOS — CID 78018133
9-[(4-chlorophenyl)methyl]-8-methylsulfinyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 78018133) has the molecular formula C20H20ClNOS and a molecular weight of 357.91 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-8-methylsulfinyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 9-[(4-chlorophenyl)methyl]-8-methylsulfinyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 78018133 |
| Molecular Formula | C20H20ClNOS |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-8-methylsulfinyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | CS(=O)c1cccc2c3c(n(Cc4ccc(Cl)cc4)c12)CCCC3 |
| InChI | InChI=1S/C20H20ClNOS/c1-24(23)19-8-4-6-17-16-5-2-3-7-18(16)22(20(17)19)13-14-9-11-15(21)12-10-14/h4,6,8-12H,2-3,5,7,13H2,1H3 |
| InChIKey | NQKMVQCBNKRBAO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|