C19H23NO2 — CID 100983044
ethyl 2-(1-benzyl-4,5,6,7-tetrahydroindol-3-yl)acetate (PubChem CID 100983044) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-4,5,6,7-tetrahydroindol-3-yl)acetate.
| Compound Name | ethyl 2-(1-benzyl-4,5,6,7-tetrahydroindol-3-yl)acetate |
|---|---|
| PubChem CID | 100983044 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 2-(1-benzyl-4,5,6,7-tetrahydroindol-3-yl)acetate |
| SMILES | CCOC(=O)Cc1cn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C19H23NO2/c1-2-22-19(21)12-16-14-20(13-15-8-4-3-5-9-15)18-11-7-6-10-17(16)18/h3-5,8-9,14H,2,6-7,10-13H2,1H3 |
| InChIKey | DMCIBXYJTFVERY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |