C22H21NO4 — CID 87677904
1-benzyl-4-ethyl-2-formyl-5-(4-methoxyphenyl)pyrrole-3-carboxylic acid (PubChem CID 87677904) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-benzyl-4-ethyl-2-formyl-5-(4-methoxyphenyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-benzyl-4-ethyl-2-formyl-5-(4-methoxyphenyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 87677904 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-benzyl-4-ethyl-2-formyl-5-(4-methoxyphenyl)pyrrole-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(C=O)n(Cc2ccccc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21NO4/c1-3-18-20(22(25)26)19(14-24)23(13-15-7-5-4-6-8-15)21(18)16-9-11-17(27-2)12-10-16/h4-12,14H,3,13H2,1-2H3,(H,25,26) |
| InChIKey | ZHBOQZBDEOZHLI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|