C20H17NO5 — CID 87677152
1-benzyl-4-ethyl-2-formyl-5-(5-formylfuran-2-yl)pyrrole-3-carboxylic acid (PubChem CID 87677152) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-benzyl-4-ethyl-2-formyl-5-(5-formylfuran-2-yl)pyrrole-3-carboxylic acid.
| Compound Name | 1-benzyl-4-ethyl-2-formyl-5-(5-formylfuran-2-yl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 87677152 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-benzyl-4-ethyl-2-formyl-5-(5-formylfuran-2-yl)pyrrole-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(C=O)n(Cc2ccccc2)c1-c1ccc(C=O)o1 |
| InChI | InChI=1S/C20H17NO5/c1-2-15-18(20(24)25)16(12-23)21(10-13-6-4-3-5-7-13)19(15)17-9-8-14(11-22)26-17/h3-9,11-12H,2,10H2,1H3,(H,24,25) |
| InChIKey | QGUREVFAZJEXSZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|