C24H21N3O2 — CID 155384804
N-hydroxy-3-(1,3,5-triphenylpyrazol-4-yl)propanamide (PubChem CID 155384804) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-hydroxy-3-(1,3,5-triphenylpyrazol-4-yl)propanamide.
| Compound Name | N-hydroxy-3-(1,3,5-triphenylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 155384804 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-hydroxy-3-(1,3,5-triphenylpyrazol-4-yl)propanamide |
| SMILES | O=C(CCc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1)NO |
| InChI | InChI=1S/C24H21N3O2/c28-22(26-29)17-16-21-23(18-10-4-1-5-11-18)25-27(20-14-8-3-9-15-20)24(21)19-12-6-2-7-13-19/h1-15,29H,16-17H2,(H,26,28) |
| InChIKey | DSTGFPROXVATPT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|