C11H13ClN4O — CID 115056429
2-[3,5-diamino-1-(3-chlorophenyl)pyrazol-4-yl]ethanol (PubChem CID 115056429) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is 2-[3,5-diamino-1-(3-chlorophenyl)pyrazol-4-yl]ethanol.
| Compound Name | 2-[3,5-diamino-1-(3-chlorophenyl)pyrazol-4-yl]ethanol |
|---|---|
| PubChem CID | 115056429 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[3,5-diamino-1-(3-chlorophenyl)pyrazol-4-yl]ethanol |
| SMILES | Nc1nn(-c2cccc(Cl)c2)c(N)c1CCO |
| InChI | InChI=1S/C11H13ClN4O/c12-7-2-1-3-8(6-7)16-11(14)9(4-5-17)10(13)15-16/h1-3,6,17H,4-5,14H2,(H2,13,15) |
| InChIKey | OODPUBNCECXMSF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |