About 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine
2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine (PubChem CID 83868844) has the molecular formula C11H11ClN4
and a molecular weight of 234.69 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine |
| PubChem CID | 83868844 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine |
| SMILES | Nc1c2c(nn1-c1cccc(Cl)c1)CNC2 |
| InChI | InChI=1S/C11H11ClN4/c12-7-2-1-3-8(4-7)16-11(13)9-5-14-6-10(9)15-16/h1-4,14H,5-6,13H2 |
| InChIKey | ACLAMEFHCWOIFJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine?
The IUPAC name of 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine (CID 83868844) is 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine.
What is the SMILES notation for 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine?
The canonical SMILES for 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine is Nc1c2c(nn1-c1cccc(Cl)c1)CNC2.
What is the InChIKey of 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine?
The InChIKey is ACLAMEFHCWOIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4/c12-7-2-1-3-8(4-7)16-11(13)9-5-14-6-10(9)15-16/h1-4,14H,5-6,13H2.
What are the key properties of 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine?
2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine has a molecular weight of 234.69 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-3-amine is sourced from PubChem (CID 83868844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).