About (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine
(5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine (PubChem CID 115057388) has the molecular formula C16H22FN
and a molecular weight of 247.36 g/mol. Its IUPAC name is (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine |
| PubChem CID | 115057388 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine |
| SMILES | NCC1CCc2c(F)cccc2C12CCCCC2 |
| InChI | InChI=1S/C16H22FN/c17-15-6-4-5-14-13(15)8-7-12(11-18)16(14)9-2-1-3-10-16/h4-6,12H,1-3,7-11,18H2 |
| InChIKey | XOYPYEKLFUOTPK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine?
The IUPAC name of (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine (CID 115057388) is (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine.
What is the SMILES notation for (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine?
The canonical SMILES for (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine is NCC1CCc2c(F)cccc2C12CCCCC2.
What is the InChIKey of (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine?
The InChIKey is XOYPYEKLFUOTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FN/c17-15-6-4-5-14-13(15)8-7-12(11-18)16(14)9-2-1-3-10-16/h4-6,12H,1-3,7-11,18H2.
What are the key properties of (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine?
(5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine has a molecular weight of 247.36 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluorospiro[3,4-dihydro-2H-naphthalene-1,1'-cyclohexane]-2-yl)methanamine is sourced from PubChem (CID 115057388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).