C14H17ClN2O — CID 115061491
5-(3-chlorophenyl)-2-piperidin-4-yl-4,5-dihydro-1,3-oxazole (PubChem CID 115061491) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-piperidin-4-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-(3-chlorophenyl)-2-piperidin-4-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 115061491 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-(3-chlorophenyl)-2-piperidin-4-yl-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1cccc(C2CN=C(C3CCNCC3)O2)c1 |
| InChI | InChI=1S/C14H17ClN2O/c15-12-3-1-2-11(8-12)13-9-17-14(18-13)10-4-6-16-7-5-10/h1-3,8,10,13,16H,4-7,9H2 |
| InChIKey | OGBPXWTWSLOFGH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |