C13H16N2O2 — CID 84695685
4-(2-pyrrolidin-3-yl-4,5-dihydro-1,3-oxazol-5-yl)phenol (PubChem CID 84695685) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(2-pyrrolidin-3-yl-4,5-dihydro-1,3-oxazol-5-yl)phenol.
| Compound Name | 4-(2-pyrrolidin-3-yl-4,5-dihydro-1,3-oxazol-5-yl)phenol |
|---|---|
| PubChem CID | 84695685 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-(2-pyrrolidin-3-yl-4,5-dihydro-1,3-oxazol-5-yl)phenol |
| SMILES | Oc1ccc(C2CN=C(C3CCNC3)O2)cc1 |
| InChI | InChI=1S/C13H16N2O2/c16-11-3-1-9(2-4-11)12-8-15-13(17-12)10-5-6-14-7-10/h1-4,10,12,14,16H,5-8H2 |
| InChIKey | UTACLSSBYZACMJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |