About [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine
[5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine (PubChem CID 115061548) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine |
| PubChem CID | 115061548 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine |
| SMILES | COc1ccccc1C1CN=C(CN)O1 |
| InChI | InChI=1S/C11H14N2O2/c1-14-9-5-3-2-4-8(9)10-7-13-11(6-12)15-10/h2-5,10H,6-7,12H2,1H3 |
| InChIKey | PEKXMXFXZITMHW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine?
The IUPAC name of [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine (CID 115061548) is [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine.
What is the SMILES notation for [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine?
The canonical SMILES for [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine is COc1ccccc1C1CN=C(CN)O1.
What is the InChIKey of [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine?
The InChIKey is PEKXMXFXZITMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-14-9-5-3-2-4-8(9)10-7-13-11(6-12)15-10/h2-5,10H,6-7,12H2,1H3.
What are the key properties of [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine?
[5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine has a molecular weight of 206.25 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methoxyphenyl)-4,5-dihydro-1,3-oxazol-2-yl]methanamine is sourced from PubChem (CID 115061548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).