5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid

C10H8FNO3 — CID 115061659

IUPAC5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid
SMILESO=C(O)C1=NCC(c2ccccc2F)O1
InChIInChI=1S/C10H8FNO3/c11-7-4-2-1-3-6(7)8-5-12-9(15-8)10(13)14/h1-4,8H,5H2,(H,13,14)
InChIKeyLWQJNZSZUQUOEE-UHFFFAOYSA-N
MW209.18 g/mol
LogP1.38
Rot. Bonds2

About 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid

5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid (PubChem CID 115061659) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid.

Molecular Properties

Compound Name5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid
PubChem CID115061659
Molecular FormulaC10H8FNO3
Molecular Weight209.18 g/mol
Exact Mass209.05
IUPAC Name5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid
SMILESO=C(O)C1=NCC(c2ccccc2F)O1
InChIInChI=1S/C10H8FNO3/c11-7-4-2-1-3-6(7)8-5-12-9(15-8)10(13)14/h1-4,8H,5H2,(H,13,14)
InChIKeyLWQJNZSZUQUOEE-UHFFFAOYSA-N
XLogP1.38
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.18
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid (CID 115061659) is 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid is O=C(O)C1=NCC(c2ccccc2F)O1.
What is the InChIKey of 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
The InChIKey is LWQJNZSZUQUOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO3/c11-7-4-2-1-3-6(7)8-5-12-9(15-8)10(13)14/h1-4,8H,5H2,(H,13,14).
What are the key properties of 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid?
5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid has a molecular weight of 209.18 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-4,5-dihydro-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 115061659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).