C11H9F6N — CID 115063800
4,7-bis(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 115063800) has the molecular formula C11H9F6N and a molecular weight of 269.19 g/mol. Its IUPAC name is 4,7-bis(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4,7-bis(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 115063800 |
| Molecular Formula | C11H9F6N |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4,7-bis(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)CNCC2C(F)(F)F |
| InChI | InChI=1S/C11H9F6N/c12-10(13,14)7-1-2-8-6(3-7)4-18-5-9(8)11(15,16)17/h1-3,9,18H,4-5H2 |
| InChIKey | AAWVGPJITVJZPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |