About (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene
(1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene (PubChem CID 162577520) has the molecular formula C16H12F4
and a molecular weight of 280.26 g/mol. Its IUPAC name is (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene |
| PubChem CID | 162577520 |
| Molecular Formula | C16H12F4 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene |
| SMILES | Fc1ccc([C@@H]2CCc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C16H12F4/c17-13-5-1-10(2-6-13)14-7-3-11-9-12(16(18,19)20)4-8-15(11)14/h1-2,4-6,8-9,14H,3,7H2/t14-/m0/s1 |
| InChIKey | ICVVNPLUDCSRBO-AWEZNQCLSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene?
The IUPAC name of (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene (CID 162577520) is (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene?
The canonical SMILES for (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene is Fc1ccc([C@@H]2CCc3cc(C(F)(F)F)ccc32)cc1.
What is the InChIKey of (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene?
The InChIKey is ICVVNPLUDCSRBO-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H12F4/c17-13-5-1-10(2-6-13)14-7-3-11-9-12(16(18,19)20)4-8-15(11)14/h1-2,4-6,8-9,14H,3,7H2/t14-/m0/s1.
What are the key properties of (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene?
(1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene has a molecular weight of 280.26 g/mol, XLogP of 4.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-fluorophenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 162577520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).