C17H15F3O — CID 15576006
6-methoxy-1-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene (PubChem CID 15576006) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-methoxy-1-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene.
| Compound Name | 6-methoxy-1-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 15576006 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-methoxy-1-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc2c(c1)C(c1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C17H15F3O/c1-21-14-8-4-12-5-9-15(16(12)10-14)11-2-6-13(7-3-11)17(18,19)20/h2-4,6-8,10,15H,5,9H2,1H3 |
| InChIKey | DOZPZTFEHUAODQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |