C13H17N3O — CID 115065578
2-(3a,4,5,6,7,7a-hexahydro-3H-imidazo[4,5-c]pyridin-2-ylmethyl)phenol (PubChem CID 115065578) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(3a,4,5,6,7,7a-hexahydro-3H-imidazo[4,5-c]pyridin-2-ylmethyl)phenol.
| Compound Name | 2-(3a,4,5,6,7,7a-hexahydro-3H-imidazo[4,5-c]pyridin-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 115065578 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(3a,4,5,6,7,7a-hexahydro-3H-imidazo[4,5-c]pyridin-2-ylmethyl)phenol |
| SMILES | Oc1ccccc1CC1=NC2CCNCC2N1 |
| InChI | InChI=1S/C13H17N3O/c17-12-4-2-1-3-9(12)7-13-15-10-5-6-14-8-11(10)16-13/h1-4,10-11,14,17H,5-8H2,(H,15,16) |
| InChIKey | BOUYCZYFTRKMDI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |