C12H19N3O — CID 175050449
2-[(6-amino-1,4-diazepan-1-yl)methyl]phenol (PubChem CID 175050449) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(6-amino-1,4-diazepan-1-yl)methyl]phenol.
| Compound Name | 2-[(6-amino-1,4-diazepan-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 175050449 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[(6-amino-1,4-diazepan-1-yl)methyl]phenol |
| SMILES | NC1CNCCN(Cc2ccccc2O)C1 |
| InChI | InChI=1S/C12H19N3O/c13-11-7-14-5-6-15(9-11)8-10-3-1-2-4-12(10)16/h1-4,11,14,16H,5-9,13H2 |
| InChIKey | FIISOXVHVSITOD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|