C14H23N3O2 — CID 155208832
2-[(6-amino-1,4-diazepan-1-yl)methyl]-3-ethoxyphenol (PubChem CID 155208832) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(6-amino-1,4-diazepan-1-yl)methyl]-3-ethoxyphenol.
| Compound Name | 2-[(6-amino-1,4-diazepan-1-yl)methyl]-3-ethoxyphenol |
|---|---|
| PubChem CID | 155208832 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-[(6-amino-1,4-diazepan-1-yl)methyl]-3-ethoxyphenol |
| SMILES | CCOc1cccc(O)c1CN1CCNCC(N)C1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-19-14-5-3-4-13(18)12(14)10-17-7-6-16-8-11(15)9-17/h3-5,11,16,18H,2,6-10,15H2,1H3 |
| InChIKey | XSBAVMKLBFCHRP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|