C15H19NO2 — CID 115066395
2-[(3-methylphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-ol (PubChem CID 115066395) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-ol.
| Compound Name | 2-[(3-methylphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 115066395 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-ol |
| SMILES | Cc1cccc(CC2=NC3CCC(O)CC3O2)c1 |
| InChI | InChI=1S/C15H19NO2/c1-10-3-2-4-11(7-10)8-15-16-13-6-5-12(17)9-14(13)18-15/h2-4,7,12-14,17H,5-6,8-9H2,1H3 |
| InChIKey | FVIKANPQQHXZQD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |