C15H17NO4 — CID 115066412
2-[(3-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid (PubChem CID 115066412) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[(3-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[(3-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 115066412 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[(3-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)C1CCC2N=C(Cc3cccc(O)c3)OC2C1 |
| InChI | InChI=1S/C15H17NO4/c17-11-3-1-2-9(6-11)7-14-16-12-5-4-10(15(18)19)8-13(12)20-14/h1-3,6,10,12-13,17H,4-5,7-8H2,(H,18,19) |
| InChIKey | VJAFAADAXONKQH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |