3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid

C11H9NO4 — CID 96609565

IUPAC3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(Cc2cccc(O)c2)no1
InChIInChI=1S/C11H9NO4/c13-9-3-1-2-7(5-9)4-8-6-10(11(14)15)16-12-8/h1-3,5-6,13H,4H2,(H,14,15)
InChIKeySFBGXZMUEVLXIK-UHFFFAOYSA-N
MW219.20 g/mol
LogP1.67
Rot. Bonds3

About 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid

3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 96609565) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid
PubChem CID96609565
Molecular FormulaC11H9NO4
Molecular Weight219.20 g/mol
Exact Mass219.05
IUPAC Name3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(Cc2cccc(O)c2)no1
InChIInChI=1S/C11H9NO4/c13-9-3-1-2-7(5-9)4-8-6-10(11(14)15)16-12-8/h1-3,5-6,13H,4H2,(H,14,15)
InChIKeySFBGXZMUEVLXIK-UHFFFAOYSA-N
XLogP1.67
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 51.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid (CID 96609565) is 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(Cc2cccc(O)c2)no1.
What is the InChIKey of 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is SFBGXZMUEVLXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c13-9-3-1-2-7(5-9)4-8-6-10(11(14)15)16-12-8/h1-3,5-6,13H,4H2,(H,14,15).
What are the key properties of 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid?
3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 219.20 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-hydroxyphenyl)methyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 96609565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).