C11H8FNO3 — CID 96607582
3-[(4-fluorophenyl)methyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 96607582) has the molecular formula C11H8FNO3 and a molecular weight of 221.19 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 96607582 |
| Molecular Formula | C11H8FNO3 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(Cc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C11H8FNO3/c12-8-3-1-7(2-4-8)5-9-6-10(11(14)15)16-13-9/h1-4,6H,5H2,(H,14,15) |
| InChIKey | CGCKSMPTRVEOFI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |