3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid

C7H8N2O4 — CID 167721826

IUPAC3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid
SMILESCC(=O)NCc1cc(C(=O)O)on1
InChIInChI=1S/C7H8N2O4/c1-4(10)8-3-5-2-6(7(11)12)13-9-5/h2H,3H2,1H3,(H,8,10)(H,11,12)
InChIKeyVSCXVWNXDCHPBA-UHFFFAOYSA-N
MW184.15 g/mol
LogP0.01
Rot. Bonds3

About 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid

3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 167721826) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid
PubChem CID167721826
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid
SMILESCC(=O)NCc1cc(C(=O)O)on1
InChIInChI=1S/C7H8N2O4/c1-4(10)8-3-5-2-6(7(11)12)13-9-5/h2H,3H2,1H3,(H,8,10)(H,11,12)
InChIKeyVSCXVWNXDCHPBA-UHFFFAOYSA-N
XLogP0.01
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 50.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid (CID 167721826) is 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid is CC(=O)NCc1cc(C(=O)O)on1.
What is the InChIKey of 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is VSCXVWNXDCHPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-4(10)8-3-5-2-6(7(11)12)13-9-5/h2H,3H2,1H3,(H,8,10)(H,11,12).
What are the key properties of 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid?
3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(acetamidomethyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 167721826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).