C15H14F3NO3 — CID 115066348
2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid (PubChem CID 115066348) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 115066348 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)C1CCC2N=C(c3ccc(C(F)(F)F)cc3)OC2C1 |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)10-4-1-8(2-5-10)13-19-11-6-3-9(14(20)21)7-12(11)22-13/h1-2,4-5,9,11-12H,3,6-7H2,(H,20,21) |
| InChIKey | QMSXBIJMMACGJV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |