C13H15FN2S — CID 115066689
2-(3-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine (PubChem CID 115066689) has the molecular formula C13H15FN2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 115066689 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-(3-fluorophenyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-6-amine |
| SMILES | NC1CCC2N=C(c3cccc(F)c3)SC2C1 |
| InChI | InChI=1S/C13H15FN2S/c14-9-3-1-2-8(6-9)13-16-11-5-4-10(15)7-12(11)17-13/h1-3,6,10-12H,4-5,7,15H2 |
| InChIKey | AAHPWHMAFVNOQJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |