C14H18N2O3 — CID 115067456
4-(2-hydroxyphenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one (PubChem CID 115067456) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 4-(2-hydroxyphenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 115067456 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-(2-hydroxyphenyl)-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1COC2(CCCNC2)CN1c1ccccc1O |
| InChI | InChI=1S/C14H18N2O3/c17-12-5-2-1-4-11(12)16-10-14(19-8-13(16)18)6-3-7-15-9-14/h1-2,4-5,15,17H,3,6-10H2 |
| InChIKey | VTQCSGUSUIWMLP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |