C16H22N2O2 — CID 115067498
4-(2-methylphenyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one (PubChem CID 115067498) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one.
| Compound Name | 4-(2-methylphenyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
|---|---|
| PubChem CID | 115067498 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(2-methylphenyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
| SMILES | Cc1ccccc1N1CC2(CCCNCC2)OCC1=O |
| InChI | InChI=1S/C16H22N2O2/c1-13-5-2-3-6-14(13)18-12-16(20-11-15(18)19)7-4-9-17-10-8-16/h2-3,5-6,17H,4,7-12H2,1H3 |
| InChIKey | UIEUFNVXLHYEDS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |