C12H13NO2S — CID 115073121
2-amino-2-(2,7-dimethyl-1-benzothiophen-3-yl)acetic acid (PubChem CID 115073121) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-amino-2-(2,7-dimethyl-1-benzothiophen-3-yl)acetic acid.
| Compound Name | 2-amino-2-(2,7-dimethyl-1-benzothiophen-3-yl)acetic acid |
|---|---|
| PubChem CID | 115073121 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-amino-2-(2,7-dimethyl-1-benzothiophen-3-yl)acetic acid |
| SMILES | Cc1sc2c(C)cccc2c1C(N)C(=O)O |
| InChI | InChI=1S/C12H13NO2S/c1-6-4-3-5-8-9(10(13)12(14)15)7(2)16-11(6)8/h3-5,10H,13H2,1-2H3,(H,14,15) |
| InChIKey | GXLZGVCZEIPRBE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |